CAS 668262-35-9 is the registry number for 4-[(2,3-Dihydro-indole-1-carbonyl)-amino]-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(2,3-dihydroindole-1-carbonylamino)benzoic acid (CAS 668262-35-9) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 4-(2,3-dihydroindole-1-carbonylamino)benzoic acid. InChIKey: XYECMUPXNOOGLJ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 4-(2,3-dihydroindole-1-carbonylamino)benzoic acid |
| InChIKey | XYECMUPXNOOGLJ-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)