CAS 106981-60-6 appears in our catalog under these names: 2-(4-Nitro-2-ethoxyphenyl)pthalimide, 95%, 2-(4-Nitro-2-ethoxyphenyl)pthalimide. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 100mg, 500mg.
2-(2-ethoxy-4-nitrophenyl)isoindole-1,3-dione (CAS 106981-60-6) is a chemical compound with the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. IUPAC name: 2-(2-ethoxy-4-nitrophenyl)isoindole-1,3-dione. InChIKey: DHMIRCIBPRTIDM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O5 |
|---|---|
| Molecular weight | 312.28 g/mol |
| IUPAC name | 2-(2-ethoxy-4-nitrophenyl)isoindole-1,3-dione |
| InChIKey | DHMIRCIBPRTIDM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[N+](=O)[O-])N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)