CAS 701238-10-0 appears in our catalog under these names: 4-([(2-Oxo-1,3-benzoxazol-3(2h)-yl)acetyl]amino)benzoic acid, 95%, 4-(2-(2-Oxobenzo(d)oxazol-3(2H)-yl)acetamido)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoic acid (CAS 701238-10-0) is a chemical compound with the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. IUPAC name: 4-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoic acid. InChIKey: IIDVFIODDVOIGB-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O5 |
|---|---|
| Molecular weight | 312.28 g/mol |
| IUPAC name | 4-[[2-(2-oxo-1,3-benzoxazol-3-yl)acetyl]amino]benzoic acid |
| InChIKey | IIDVFIODDVOIGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)O2)CC(=O)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)