CAS 98395-64-3 is the registry number for N-[2-(2-Nitrophenoxy)ethyl]phthalimide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[2-(2-nitrophenoxy)ethyl]isoindole-1,3-dione (CAS 98395-64-3) is a chemical compound with the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. IUPAC name: 2-[2-(2-nitrophenoxy)ethyl]isoindole-1,3-dione. InChIKey: QVYXLUNMNXBJCP-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O5 |
|---|---|
| Molecular weight | 312.28 g/mol |
| IUPAC name | 2-[2-(2-nitrophenoxy)ethyl]isoindole-1,3-dione |
| InChIKey | QVYXLUNMNXBJCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCOC3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)