Products 2616551-00-7
CAS 2616551-00-7 is the registry number for 2-(2,6-Dioxopiperidin-3-yl)-5,7-dihydrocyclopenta[f]isoindole-1,3,6(2H)-trione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dioxopiperidin-3-yl)-5,7-dihydrocyclopenta[f]isoindole-1,3,6-trione (CAS 2616551-00-7) is a chemical compound with the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5,7-dihydrocyclopenta[f]isoindole-1,3,6-trione. InChIKey: WXSMXVGIZZUTBM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O5 |
|---|---|
| Molecular weight | 312.28 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5,7-dihydrocyclopenta[f]isoindole-1,3,6-trione |
| InChIKey | WXSMXVGIZZUTBM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C4CC(=O)CC4=C3 |
Computed by PubChem (NCBI)