Products 1216805-67-2
CAS 1216805-67-2 is the registry number for Thalidomide-propargyl-MeOH. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-4-(3-hydroxyprop-1-ynyl)isoindole-1,3-dione (CAS 1216805-67-2) is a chemical compound with the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4-(3-hydroxyprop-1-ynyl)isoindole-1,3-dione. InChIKey: PDVQCRGWUAGFKJ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O5 |
|---|---|
| Molecular weight | 312.28 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4-(3-hydroxyprop-1-ynyl)isoindole-1,3-dione |
| InChIKey | PDVQCRGWUAGFKJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC(=C3C2=O)C#CCO |
Computed by PubChem (NCBI)