Products 1070505-53-1

CAS 1070505-53-1 is the registry number for rac Bepotastine. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

4-[4-[(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoic acid (CAS 1070505-53-1) is a chemical compound with the molecular formula C21H25ClN2O3 and a molecular weight of 388.9 g/mol. IUPAC name: 4-[4-[(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoic acid. InChIKey: YWGDOWXRIALTES-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25ClN2O3
Molecular weight388.9 g/mol
IUPAC name4-[4-[(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoic acid
InChIKeyYWGDOWXRIALTES-UHFFFAOYSA-N
SMILESC1CN(CCC1OC(C2=CC=C(C=C2)Cl)C3=CC=CC=N3)CCCC(=O)O

Computed by PubChem (NCBI)