Products 1071328-75-0

CAS 1071328-75-0 is the registry number for 2-((3-Bromophenyl)amino)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

2-(3-bromoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1071328-75-0) is a chemical compound with the molecular formula C11H9BrN2O2S and a molecular weight of 313.17 g/mol. IUPAC name: 2-(3-bromoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: LRAHXFBQJGFQBE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9BrN2O2S
Molecular weight313.17 g/mol
IUPAC name2-(3-bromoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyLRAHXFBQJGFQBE-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)NC2=CC(=CC=C2)Br)C(=O)O

Computed by PubChem (NCBI)