Products 1071346-87-6
CAS 1071346-87-6 is the registry number for 6-Methoxy-5-nitrobenzo[d]thiazol-2-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg.
6-methoxy-5-nitro-1,3-benzothiazol-2-amine (CAS 1071346-87-6) is a chemical compound with the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. IUPAC name: 6-methoxy-5-nitro-1,3-benzothiazol-2-amine. InChIKey: AQIPCUMJMPWGRJ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3S |
|---|---|
| Molecular weight | 225.23 g/mol |
| IUPAC name | 6-methoxy-5-nitro-1,3-benzothiazol-2-amine |
| InChIKey | AQIPCUMJMPWGRJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)SC(=N2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)