Products 1071466-57-3
CAS 1071466-57-3 is the registry number for Bisphenol a acetate propionate, epoxy curative, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g.
[4-[2-(4-acetyloxyphenyl)propan-2-yl]phenyl] propanoate (CAS 1071466-57-3) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: [4-[2-(4-acetyloxyphenyl)propan-2-yl]phenyl] propanoate. InChIKey: VWMUCEDXVAQLNS-UHFFFAOYSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | [4-[2-(4-acetyloxyphenyl)propan-2-yl]phenyl] propanoate |
| InChIKey | VWMUCEDXVAQLNS-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1=CC=C(C=C1)C(C)(C)C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)