CAS 855254-76-1 appears in our catalog under these names: Diethyl 2,2'-dimethylbiphenyl-4,4'-dicarboxylate, 95%, Diethyl 2,2'–dimethylbiphenyl–4,4'–dicarboxylate, Diethyl 2,2'-dimethylbiphenyl-4,4'-dicarboxylate, Diethyl 2,2'-dimethylbiphenyl-4,4'-dicarboxylate, >=95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
Ethyl 4-(4-ethoxycarbonyl-2-methylphenyl)-3-methylbenzoate (CAS 855254-76-1) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: ethyl 4-(4-ethoxycarbonyl-2-methylphenyl)-3-methylbenzoate. InChIKey: NQAJKEFVVKYKNC-UHFFFAOYSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | ethyl 4-(4-ethoxycarbonyl-2-methylphenyl)-3-methylbenzoate |
| InChIKey | NQAJKEFVVKYKNC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C2=C(C=C(C=C2)C(=O)OCC)C)C |
Computed by PubChem (NCBI)