Products 94561-67-8
CAS 94561-67-8 is the registry number for Ketoprofen 2,3-Butylene Glycol Ester. Offered by: Mikromol. Available pack sizes: 100mg.
3-hydroxybutan-2-yl 2-(3-benzoylphenyl)propanoate (CAS 94561-67-8) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: 3-hydroxybutan-2-yl 2-(3-benzoylphenyl)propanoate. InChIKey: FMAWHZICIBCERI-UHFFFAOYSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 3-hydroxybutan-2-yl 2-(3-benzoylphenyl)propanoate |
| InChIKey | FMAWHZICIBCERI-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)OC(C)C(C)O |
Computed by PubChem (NCBI)