Products 852369-40-5
CAS 852369-40-5 appears in our catalog under these names: Benzene Kresoxim-Methyl, Benmijunzhi, >95% (HPLC), Benmijunzhi, Benmijunzhi, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 250mg, 500mg, 50mg, 10mg, 1x10mg, 1x1ml.
Methyl (E)-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate (CAS 852369-40-5) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: methyl (E)-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate. InChIKey: DYFHTHIEAZGGDF-QGOAFFKASA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | methyl (E)-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-3-methoxyprop-2-enoate |
| InChIKey | DYFHTHIEAZGGDF-QGOAFFKASA-N |
| SMILES | CC1=CC(=C(C=C1)C)OCC2=CC=CC=C2/C(=C\OC)/C(=O)OC |
Computed by PubChem (NCBI)