Products 2451-84-5
CAS 2451-84-5 appears in our catalog under these names: Adipic acid dibenzyl ester, 95%, Dibenzyl Adipate, Dibenzyl Adipate, >95.0%(GC), Dibenzyl Adipate 95%, Adipic acid dibenzyl ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, Get quote.
Dibenzyl hexanedioate (CAS 2451-84-5) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: dibenzyl hexanedioate. InChIKey: AEUORZZHALJMBM-UHFFFAOYSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | dibenzyl hexanedioate |
| InChIKey | AEUORZZHALJMBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)