CAS 1071537-11-5 appears in our catalog under these names: 2-(1-Benzyl-1H-pyrazol-4-yl)ethan-1-amine dihydrochloride, 95%, 2-(1-Benzyl-1H-pyrazol-4-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(1-benzylpyrazol-4-yl)ethanamine;dihydrochloride (CAS 1071537-11-5) is a chemical compound with the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. IUPAC name: 2-(1-benzylpyrazol-4-yl)ethanamine;dihydrochloride. InChIKey: GJIGROAPLITWPH-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | 2-(1-benzylpyrazol-4-yl)ethanamine;dihydrochloride |
| InChIKey | GJIGROAPLITWPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)