CAS 1185692-43-6 appears in our catalog under these names: 5-Methyl-2-pyrrolidin-2-yl-1h-benzimidazole dihydrochloride, 95%, 5-Methyl-2-(pyrrolidin-2-yl)-1H-1,3-benzodiazole dihydrochloride, 98%, 6-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole dihydrochloride, 5-methyl-2-(pyrrolidin-2-yl)-1H-1,3-benzodiazole dihydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
6-methyl-2-pyrrolidin-2-yl-1H-benzimidazole;dihydrochloride (CAS 1185692-43-6) is a chemical compound with the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. IUPAC name: 6-methyl-2-pyrrolidin-2-yl-1H-benzimidazole;dihydrochloride. InChIKey: ZRLJKCZRAZUINA-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | 6-methyl-2-pyrrolidin-2-yl-1H-benzimidazole;dihydrochloride |
| InChIKey | ZRLJKCZRAZUINA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCCN3.Cl.Cl |
Computed by PubChem (NCBI)