CAS 255714-24-0 appears in our catalog under these names: 4-(1-Piperazinyl)-1h-indole dihydrochloride, 95%, 4-(1-Piperazinyl)-1H-indole Dihydrochloride, 4–(1–piperazinyl)–1H–Indole (hydrochloride), 1H-Indole-4-(1-piperazinyl)dihydrochloride, 4-(1-Piperazinyl)-1H-Indole (hydrochloride). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 25mg, 500mg, 10g, 50 mg, 100 mg.
4-piperazin-1-yl-1H-indole;dihydrochloride (CAS 255714-24-0) is a chemical compound with the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. IUPAC name: 4-piperazin-1-yl-1H-indole;dihydrochloride. InChIKey: FHRAUNYCUBSDMF-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | 4-piperazin-1-yl-1H-indole;dihydrochloride |
| InChIKey | FHRAUNYCUBSDMF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC3=C2C=CN3.Cl.Cl |
Computed by PubChem (NCBI)