CAS 1158527-40-2 appears in our catalog under these names: 4-[(3,5-Dimethyl-1h-pyrazol-1-yl)methyl]aniline dihydrochloride, 95%, 4-((3,5-Dimethyl-1H-pyrazol-1-yl)methyl)aniline dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
4-[(3,5-dimethylpyrazol-1-yl)methyl]aniline;dihydrochloride (CAS 1158527-40-2) is a chemical compound with the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. IUPAC name: 4-[(3,5-dimethylpyrazol-1-yl)methyl]aniline;dihydrochloride. InChIKey: ACMFNEADGQXGJL-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]aniline;dihydrochloride |
| InChIKey | ACMFNEADGQXGJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC=C(C=C2)N)C.Cl.Cl |
Computed by PubChem (NCBI)