CAS 1185295-25-3 appears in our catalog under these names: 2-(Piperidin-4-yl)-1h-pyrrolo[2,3-b]pyridine dihydrochloride, 95%, 2-(Piperidin-4-yl)-1H-pyrrolo(2,3-b)pyridine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine;dihydrochloride (CAS 1185295-25-3) is a chemical compound with the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. IUPAC name: 2-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine;dihydrochloride. InChIKey: HTOFEQOONPTXPU-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | 2-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine;dihydrochloride |
| InChIKey | HTOFEQOONPTXPU-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC3=C(N2)N=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)