Products 1072069-91-0
CAS 1072069-91-0 is the registry number for 3-(2,3,3-Trimethyl-3h-indol-5-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2,3,3-trimethylindol-5-yl)propanoic acid (CAS 1072069-91-0) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: 3-(2,3,3-trimethylindol-5-yl)propanoic acid. InChIKey: QIMIOCZMNPBLPO-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3-(2,3,3-trimethylindol-5-yl)propanoic acid |
| InChIKey | QIMIOCZMNPBLPO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)CCC(=O)O |
Computed by PubChem (NCBI)