Products 1072315-89-9
CAS 1072315-89-9 is the registry number for 9-METHYL-9H-FLUORENE-9-CARBONYL-13C CHLO. Offered by: Sigma-Aldrich. Available pack sizes: 1G, 250MG.
9-methylfluorene-9-carbonyl chloride (CAS 1072315-89-9) is a chemical compound with the molecular formula C15H11ClO and a molecular weight of 243.69 g/mol. IUPAC name: 9-methylfluorene-9-carbonyl chloride. InChIKey: ZQYOOHGEBHBNTP-UJKGMGNHSA-N.
| Molecular formula | C15H11ClO |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 9-methylfluorene-9-carbonyl chloride |
| InChIKey | ZQYOOHGEBHBNTP-UJKGMGNHSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC=CC=C31)[13C](=O)Cl |
Computed by PubChem (NCBI)