CAS 1072429-95-8 is the registry number for 4,7-Dichloro-1H-indazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dichloro-2H-indazole-3-carboxylic acid (CAS 1072429-95-8) is a chemical compound with the molecular formula C8H4Cl2N2O2 and a molecular weight of 231.03 g/mol. IUPAC name: 4,7-dichloro-2H-indazole-3-carboxylic acid. InChIKey: PRQLHXTYRVCGSL-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O2 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | 4,7-dichloro-2H-indazole-3-carboxylic acid |
| InChIKey | PRQLHXTYRVCGSL-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NN=C2C(=C1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)