CAS 353258-33-0 appears in our catalog under these names: 6,8-Dichloroimidazo(1,2-a)pyridine-2-carboxylic acid, 95%, 6,8-Dichloroimidazo(1,2-a)pyridine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6,8-dichloroimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 353258-33-0) is a chemical compound with the molecular formula C8H4Cl2N2O2 and a molecular weight of 231.03 g/mol. IUPAC name: 6,8-dichloroimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: OKRIIMVNXKTCPK-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O2 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | 6,8-dichloroimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | OKRIIMVNXKTCPK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN2C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)