CAS 1227954-34-8 is the registry number for 3,5-Dichloroimidazo[1,2-a]pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3,5-dichloroimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 1227954-34-8) is a chemical compound with the molecular formula C8H4Cl2N2O2 and a molecular weight of 231.03 g/mol. IUPAC name: 3,5-dichloroimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: OMBATAGDYCDDMJ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O2 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | 3,5-dichloroimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | OMBATAGDYCDDMJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C(=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)