Products 1256807-21-2

CAS 1256807-21-2 is the registry number for 4,6-Dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid (CAS 1256807-21-2) is a chemical compound with the molecular formula C8H4Cl2N2O2 and a molecular weight of 231.03 g/mol. IUPAC name: 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid. InChIKey: CLWHQBGYQNRIHS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2N2O2
Molecular weight231.03 g/mol
IUPAC name4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid
InChIKeyCLWHQBGYQNRIHS-UHFFFAOYSA-N
SMILESC1=C2C(=C(N=C1Cl)Cl)C=C(N2)C(=O)O

Computed by PubChem (NCBI)