Products 1341232-15-2
CAS 1341232-15-2 is the registry number for Methyl 2,5-dichloro-6-cyanonicotinate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,5-dichloro-6-cyanopyridine-3-carboxylate (CAS 1341232-15-2) is a chemical compound with the molecular formula C8H4Cl2N2O2 and a molecular weight of 231.03 g/mol. IUPAC name: methyl 2,5-dichloro-6-cyanopyridine-3-carboxylate. InChIKey: KKRPXIDOVGJDMU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O2 |
|---|---|
| Molecular weight | 231.03 g/mol |
| IUPAC name | methyl 2,5-dichloro-6-cyanopyridine-3-carboxylate |
| InChIKey | KKRPXIDOVGJDMU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1Cl)C#N)Cl |
Computed by PubChem (NCBI)