Products 1072444-55-3
CAS 1072444-55-3 appears in our catalog under these names: Benzaldehyden, 2-((1R,2R)-2-Formyl-1,3,3-trimethylcyclohexyl)-4-hydroxy-5-isopropylbenzaldehyde. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
2-(2-formyl-1,3,3-trimethylcyclohexyl)-4-hydroxy-5-propan-2-ylbenzaldehyde (CAS 1072444-55-3) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: 2-(2-formyl-1,3,3-trimethylcyclohexyl)-4-hydroxy-5-propan-2-ylbenzaldehyde. InChIKey: WFKAJHXRTWDPAT-UHFFFAOYSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2-(2-formyl-1,3,3-trimethylcyclohexyl)-4-hydroxy-5-propan-2-ylbenzaldehyde |
| InChIKey | WFKAJHXRTWDPAT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C(=C1)C=O)C2(CCCC(C2C=O)(C)C)C)O |
Computed by PubChem (NCBI)