Products 1072855-65-2
CAS 1072855-65-2 is the registry number for 6-(Cyclopentylsulfonyl)nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-cyclopentylsulfonylpyridine-3-carboxylic acid (CAS 1072855-65-2) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 6-cyclopentylsulfonylpyridine-3-carboxylic acid. InChIKey: VPAZRWGQPNUMAN-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 6-cyclopentylsulfonylpyridine-3-carboxylic acid |
| InChIKey | VPAZRWGQPNUMAN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)S(=O)(=O)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)