CAS 1072946-03-2 appears in our catalog under these names: (3-(p-Tolylcarbamoyl),phenyl),boronic acid, 95%, 95%, (3-(p-Tolylcarbamoyl)phenyl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g.
[3-[(4-methylphenyl)carbamoyl]phenyl]boronic acid (CAS 1072946-03-2) is a chemical compound with the molecular formula C14H14BNO3 and a molecular weight of 255.08 g/mol. IUPAC name: [3-[(4-methylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: CCZJEJMKNHPTNG-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO3 |
|---|---|
| Molecular weight | 255.08 g/mol |
| IUPAC name | [3-[(4-methylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | CCZJEJMKNHPTNG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)