Products 1841504-28-6

CAS 1841504-28-6 is the registry number for (4-(Benzamidomethyl)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-(benzamidomethyl)phenyl]boronic acid (CAS 1841504-28-6) is a chemical compound with the molecular formula C14H14BNO3 and a molecular weight of 255.08 g/mol. IUPAC name: [4-(benzamidomethyl)phenyl]boronic acid. InChIKey: XRWKDZDOPVKEGI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14BNO3
Molecular weight255.08 g/mol
IUPAC name[4-(benzamidomethyl)phenyl]boronic acid
InChIKeyXRWKDZDOPVKEGI-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2)(O)O

Computed by PubChem (NCBI)