CAS 252663-47-1 appears in our catalog under these names: 4–(N–Benzylaminocarbonyl)phenylboronic acid, (4-(Benzylcarbamoyl)phenyl)boronic acid 98%, 4-(N-Benzylaminocarbonyl)Phenylboronic Acid, 95%, 95%, (4-(Benzylcarbamoyl)phenyl)boronic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 1g, 5g, 25g, 100g, 10g, 50g.
[4-(benzylcarbamoyl)phenyl]boronic acid (CAS 252663-47-1) is a chemical compound with the molecular formula C14H14BNO3 and a molecular weight of 255.08 g/mol. IUPAC name: [4-(benzylcarbamoyl)phenyl]boronic acid. InChIKey: AAUCAVUVHBOOPF-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO3 |
|---|---|
| Molecular weight | 255.08 g/mol |
| IUPAC name | [4-(benzylcarbamoyl)phenyl]boronic acid |
| InChIKey | AAUCAVUVHBOOPF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)