CAS 913198-24-0 appears in our catalog under these names: [4-[[(4-Methylphenyl)amino]-carbonyl]phenyl]boronic acid, 95%, B–(4–(((4–Methylphenyl)amino)carbonyl)phenyl)boronic acid, B-[4-[[(4-Methylphenyl)amino]carbonyl]phenyl]boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
[4-[(4-methylphenyl)carbamoyl]phenyl]boronic acid (CAS 913198-24-0) is a chemical compound with the molecular formula C14H14BNO3 and a molecular weight of 255.08 g/mol. IUPAC name: [4-[(4-methylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: RIZGBYIWLBWDNQ-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO3 |
|---|---|
| Molecular weight | 255.08 g/mol |
| IUPAC name | [4-[(4-methylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | RIZGBYIWLBWDNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)