CAS 1187230-70-1 appears in our catalog under these names: Crisaborole Impurity 34, 4-((1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-5-yl)oxy)-benzenemethanamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methanamine (CAS 1187230-70-1) is a chemical compound with the molecular formula C14H14BNO3 and a molecular weight of 255.08 g/mol. IUPAC name: [4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methanamine. InChIKey: USQKBFNKMYRGGS-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO3 |
|---|---|
| Molecular weight | 255.08 g/mol |
| IUPAC name | [4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methanamine |
| InChIKey | USQKBFNKMYRGGS-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OC3=CC=C(C=C3)CN)O |
Computed by PubChem (NCBI)