Products 1073339-15-7
CAS 1073339-15-7 is the registry number for Methyl 2-chloro-4-fluoro-5-hydroxybenzoate, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-chloro-4-fluoro-5-hydroxybenzoate (CAS 1073339-15-7) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: methyl 2-chloro-4-fluoro-5-hydroxybenzoate. InChIKey: WFOHOYRYVTZBMI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | methyl 2-chloro-4-fluoro-5-hydroxybenzoate |
| InChIKey | WFOHOYRYVTZBMI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)F)O |
Computed by PubChem (NCBI)