Products 1073642-78-0
CAS 1073642-78-0 is the registry number for 3-Methoxy-5-phenylacetophenone. Offered by: TRC. Available pack sizes: 1g.
1-(3-methoxy-5-phenylphenyl)ethanone (CAS 1073642-78-0) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 1-(3-methoxy-5-phenylphenyl)ethanone. InChIKey: ZLLGHUMRZLIUPU-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 1-(3-methoxy-5-phenylphenyl)ethanone |
| InChIKey | ZLLGHUMRZLIUPU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)