CAS 107377-26-4 is the registry number for 3–phenyl–4H–thieno(3,2–b)pyrrole–5–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
3-phenyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 107377-26-4) is a chemical compound with the molecular formula C13H9NO2S and a molecular weight of 243.28 g/mol. IUPAC name: 3-phenyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: RGYSMXBFWMLWNY-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 3-phenyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | RGYSMXBFWMLWNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2NC(=C3)C(=O)O |
Computed by PubChem (NCBI)