Products 68230-59-1
CAS 68230-59-1 appears in our catalog under these names: 10H-Phenothiazine-3-carboxylic acid, 95%, 10H-phenothiazine-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
10H-phenothiazine-3-carboxylic acid (CAS 68230-59-1) is a chemical compound with the molecular formula C13H9NO2S and a molecular weight of 243.28 g/mol. IUPAC name: 10H-phenothiazine-3-carboxylic acid. InChIKey: ZAZBAXPDYNCBBL-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 10H-phenothiazine-3-carboxylic acid |
| InChIKey | ZAZBAXPDYNCBBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)