CAS 20290-48-6 appears in our catalog under these names: Dibenzo(b,f)(1,4)thiazepin-11(10H)-one, 5-oxide, Dibenzo(b,f)(1,4)thiazepin-11(10H)-one 5-oxide. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 0,5g, 0,25g, 1g.
11-oxo-5H-benzo[b][1,4]benzothiazepin-6-one (CAS 20290-48-6) is a chemical compound with the molecular formula C13H9NO2S and a molecular weight of 243.28 g/mol. IUPAC name: 11-oxo-5H-benzo[b][1,4]benzothiazepin-6-one. InChIKey: LPGBNFSOYNAJTR-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 11-oxo-5H-benzo[b][1,4]benzothiazepin-6-one |
| InChIKey | LPGBNFSOYNAJTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=CC=CC=C3S2=O |
Computed by PubChem (NCBI)