CAS 775315-02-1 is the registry number for 2-(Thiophene-2-carbonyl)-1-benzofuran-3-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(3-amino-1-benzofuran-2-yl)-thiophen-2-ylmethanone (CAS 775315-02-1) is a chemical compound with the molecular formula C13H9NO2S and a molecular weight of 243.28 g/mol. IUPAC name: (3-amino-1-benzofuran-2-yl)-thiophen-2-ylmethanone. InChIKey: POWVVEYISURNNE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | (3-amino-1-benzofuran-2-yl)-thiophen-2-ylmethanone |
| InChIKey | POWVVEYISURNNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(O2)C(=O)C3=CC=CS3)N |
Computed by PubChem (NCBI)