CAS 25234-50-8 appears in our catalog under these names: 10H-Phenothiazine-2-carboxylic acid, 95%, 10H-Phenothiazine-2-carboxylic acid, 97%, 97%, 10H-Phenothiazine-2-carboxylic acid, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 50mg, 100mg, 1g.
10H-phenothiazine-2-carboxylic acid (CAS 25234-50-8) is a chemical compound with the molecular formula C13H9NO2S and a molecular weight of 243.28 g/mol. IUPAC name: 10H-phenothiazine-2-carboxylic acid. InChIKey: CBFANMJNNUVDTB-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 10H-phenothiazine-2-carboxylic acid |
| InChIKey | CBFANMJNNUVDTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)