Products 107428-05-7

CAS 107428-05-7 is the registry number for Dimethyl 2,2-di(but-2-yn-1-yl)malonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 2,2-bis(but-2-ynyl)propanedioate (CAS 107428-05-7) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: dimethyl 2,2-bis(but-2-ynyl)propanedioate. InChIKey: ZCPCGZQWOHHKMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC namedimethyl 2,2-bis(but-2-ynyl)propanedioate
InChIKeyZCPCGZQWOHHKMZ-UHFFFAOYSA-N
SMILESCC#CCC(CC#CC)(C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)