Products 107485-44-9
CAS 107485-44-9 appears in our catalog under these names: 2-(Dimethylamino)-6-fluorobenzamide, 95%, 2–(Dimethylamino)–6–fluorobenzamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g.
2-(dimethylamino)-6-fluorobenzamide (CAS 107485-44-9) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 2-(dimethylamino)-6-fluorobenzamide. InChIKey: OOCPQLDZKZSIEG-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-(dimethylamino)-6-fluorobenzamide |
| InChIKey | OOCPQLDZKZSIEG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=CC=C1)F)C(=O)N |
Computed by PubChem (NCBI)