CAS 1094352-35-8 appears in our catalog under these names: 2-Amino-5-fluoro-n,n-dimethylbenzamide, 95%, 2-amino-5-fluoro-N,N-dimethylbenzamide, 97%, 97%, 2-Amino-5-fluoro-N,N-dimethylbenzamide, 97%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-amino-5-fluoro-N,N-dimethylbenzamide (CAS 1094352-35-8) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 2-amino-5-fluoro-N,N-dimethylbenzamide. InChIKey: LSXZWDBINMAGOI-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-amino-5-fluoro-N,N-dimethylbenzamide |
| InChIKey | LSXZWDBINMAGOI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)