CAS 1369862-70-3 appears in our catalog under these names: 3-Amino-5-fluoro-N,N-dimethylbenzamide, 3-Amino-5-fluoro-n,n-dimethylbenzamide, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 5g, 250mg, 1g.
3-amino-5-fluoro-N,N-dimethylbenzamide (CAS 1369862-70-3) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 3-amino-5-fluoro-N,N-dimethylbenzamide. InChIKey: IMGAVXJRJPEFQA-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 3-amino-5-fluoro-N,N-dimethylbenzamide |
| InChIKey | IMGAVXJRJPEFQA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)F)N |
Computed by PubChem (NCBI)