CAS 1862963-13-0 appears in our catalog under these names: 5-Amino-4-fluoro-n,2-dimethylbenzamide, 95%, 5-Amino-4-fluoro-N,2-dimethylbenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
5-amino-4-fluoro-N,2-dimethylbenzamide (CAS 1862963-13-0) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 5-amino-4-fluoro-N,2-dimethylbenzamide. InChIKey: FVSGDQCUVZNJAT-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 5-amino-4-fluoro-N,2-dimethylbenzamide |
| InChIKey | FVSGDQCUVZNJAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)NC)N)F |
Computed by PubChem (NCBI)