CAS 152535-12-1 appears in our catalog under these names: N-(2-Aminoethyl)-2-fluorobenzamide, 98%, N-(2-Aminoethyl)-2-fluorobenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
N-(2-aminoethyl)-2-fluorobenzamide (CAS 152535-12-1) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: N-(2-aminoethyl)-2-fluorobenzamide. InChIKey: DLBGTHACSSJFCX-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | N-(2-aminoethyl)-2-fluorobenzamide |
| InChIKey | DLBGTHACSSJFCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCN)F |
Computed by PubChem (NCBI)