CAS 1075281-18-3 appears in our catalog under these names: methyl 5-bromo-4-(bromomethyl)-2-methoxybenzoate, 95%, Methyl 5-bromo-4-(bromomethyl)-2-methoxybenzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 0,5g.
Methyl 5-bromo-4-(bromomethyl)-2-methoxybenzoate (CAS 1075281-18-3) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: methyl 5-bromo-4-(bromomethyl)-2-methoxybenzoate. InChIKey: DYTNTMQRUUZCGS-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | methyl 5-bromo-4-(bromomethyl)-2-methoxybenzoate |
| InChIKey | DYTNTMQRUUZCGS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CBr)Br)C(=O)OC |
Computed by PubChem (NCBI)