CAS 90798-55-3 appears in our catalog under these names: Ethyl 2-(2,4-dibromophenoxy)acetate, 98%, Ethyl 2-(2,4-dibromophenoxy)acetate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Ethyl 2-(2,4-dibromophenoxy)acetate (CAS 90798-55-3) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: ethyl 2-(2,4-dibromophenoxy)acetate. InChIKey: PUKHSXCWPAOOSE-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | ethyl 2-(2,4-dibromophenoxy)acetate |
| InChIKey | PUKHSXCWPAOOSE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)