CAS 188199-76-0 is the registry number for 2,2-Dibromo-1-(3,5-dimethoxyphenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(3,5-dimethoxyphenyl)ethanone (CAS 188199-76-0) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: 2,2-dibromo-1-(3,5-dimethoxyphenyl)ethanone. InChIKey: OSOQNVNAZMMIKL-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | 2,2-dibromo-1-(3,5-dimethoxyphenyl)ethanone |
| InChIKey | OSOQNVNAZMMIKL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)C(Br)Br)OC |
Computed by PubChem (NCBI)