CAS 807631-08-9 is the registry number for 2-Bromo-1-(4-bromo-2,5-dimethoxy-phenyl)ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(4-bromo-2,5-dimethoxyphenyl)ethanone (CAS 807631-08-9) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: 2-bromo-1-(4-bromo-2,5-dimethoxyphenyl)ethanone. InChIKey: DQVKFZDHKLHBDR-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | 2-bromo-1-(4-bromo-2,5-dimethoxyphenyl)ethanone |
| InChIKey | DQVKFZDHKLHBDR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)CBr)OC)Br |
Computed by PubChem (NCBI)